C18H16ClN2O4- — CID 9016363
2-[4-[(Z)-N-[(2-chlorobenzoyl)amino]-C-ethylcarbonimidoyl]phenoxy]acetate (PubChem CID 9016363) has the molecular formula C18H16ClN2O4- and a molecular weight of 359.79 g/mol. Its IUPAC name is 2-[4-[(Z)-N-[(2-chlorobenzoyl)amino]-C-ethylcarbonimidoyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-N-[(2-chlorobenzoyl)amino]-C-ethylcarbonimidoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9016363 |
| Molecular Formula | C18H16ClN2O4- |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[4-[(Z)-N-[(2-chlorobenzoyl)amino]-C-ethylcarbonimidoyl]phenoxy]acetate |
| SMILES | CC/C(=N/NC(=O)c1ccccc1Cl)c1ccc(OCC(=O)[O-])cc1 |
| InChI | InChI=1S/C18H17ClN2O4/c1-2-16(12-7-9-13(10-8-12)25-11-17(22)23)20-21-18(24)14-5-3-4-6-15(14)19/h3-10H,2,11H2,1H3,(H,21,24)(H,22,23)/p-1/b20-16- |
| InChIKey | SYUAXZYPNHRQPL-SILNSSARSA-M |
| XLogP | 2.01 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|