C22H16F4N2O2 — CID 90755250
5-(2-fluoro-3-pyridinyl)-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90755250) has the molecular formula C22H16F4N2O2 and a molecular weight of 416.37 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90755250 |
| Molecular Formula | C22H16F4N2O2 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Cc1cc(-c2cccnc2F)cc2cn(Cc3ccc(OC(F)(F)F)cc3)c(O)c12 |
| InChI | InChI=1S/C22H16F4N2O2/c1-13-9-15(18-3-2-8-27-20(18)23)10-16-12-28(21(29)19(13)16)11-14-4-6-17(7-5-14)30-22(24,25)26/h2-10,12,29H,11H2,1H3 |
| InChIKey | WYLDNJDDMAZCCI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|