C15H18 — CID 90758670
5,11-dimethyl-3,5-dihydro-2H-benzo[9]annulene (PubChem CID 90758670) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 5,11-dimethyl-3,5-dihydro-2H-benzo[9]annulene.
| Compound Name | 5,11-dimethyl-3,5-dihydro-2H-benzo[9]annulene |
|---|---|
| PubChem CID | 90758670 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5,11-dimethyl-3,5-dihydro-2H-benzo[9]annulene |
| SMILES | CC1=CC=CC=CC(C)C2=CCCC=C12 |
| InChI | InChI=1S/C15H18/c1-12-8-4-3-5-9-13(2)15-11-7-6-10-14(12)15/h3-5,8-12H,6-7H2,1-2H3 |
| InChIKey | AAXOYVCRFDEVHX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |