C61H57NO7S — CID 90760568
4-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)furan-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)thiophen-2-yl]benzaldehyde (PubChem CID 90760568) has the molecular formula C61H57NO7S and a molecular weight of 948.19 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)furan-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)thiophen-2-yl]benzaldehyde.
| Compound Name | 4-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)furan-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)thiophen-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 90760568 |
| Molecular Formula | C61H57NO7S |
| Molecular Weight | 948.19 g/mol |
| Exact Mass | 947.39 |
| IUPAC Name | 4-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)furan-2-yl]benzaldehyde;4-[5-(4-pentoxyphenyl)thiophen-2-yl]benzaldehyde |
| SMILES | CCCCCOc1ccc(-c2ccc(-c3ccc(C=O)cc3)o2)cc1.CCCCCOc1ccc(-c2ccc(-c3ccc(C=O)cc3)s2)cc1.Cc1ccc(-c2cnc(-c3ccc(C=O)cc3)o2)cc1 |
| InChI | InChI=1S/C22H22O3.C22H22O2S.C17H13NO2/c2*1-2-3-4-15-24-20-11-9-19(10-12-20)22-14-13-21(25-22)18-7-5-17(16-23)6-8-18;1-12-2-6-14(7-3-12)16-10-18-17(20-16)15-8-4-13(11-19)5-9-15/h2*5-14,16H,2-4,15H2,1H3;2-11H,1H3 |
| InChIKey | VGMMSZBZRXNDLZ-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 108.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.19 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|