C12H28OSi — CID 90761440
tert-butyl-(2,3-dimethylbutan-2-yloxy)-dimethylsilane (PubChem CID 90761440) has the molecular formula C12H28OSi and a molecular weight of 216.44 g/mol. Its IUPAC name is tert-butyl-(2,3-dimethylbutan-2-yloxy)-dimethylsilane.
| Compound Name | tert-butyl-(2,3-dimethylbutan-2-yloxy)-dimethylsilane |
|---|---|
| PubChem CID | 90761440 |
| Molecular Formula | C12H28OSi |
| Molecular Weight | 216.44 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | tert-butyl-(2,3-dimethylbutan-2-yloxy)-dimethylsilane |
| SMILES | CC(C)C(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28OSi/c1-10(2)12(6,7)13-14(8,9)11(3,4)5/h10H,1-9H3 |
| InChIKey | WVSZQJQCOFKJCF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|