C24H30F3N5O6S2 — CID 90761492
[2-methyl-5-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;trifluoromethanesulfonate (PubChem CID 90761492) has the molecular formula C24H30F3N5O6S2 and a molecular weight of 605.66 g/mol. Its IUPAC name is [2-methyl-5-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;trifluoromethanesulfonate.
| Compound Name | [2-methyl-5-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90761492 |
| Molecular Formula | C24H30F3N5O6S2 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | [2-methyl-5-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;trifluoromethanesulfonate |
| SMILES | CC1CCN(C(=O)c2ccc3c(c2)c2c(n3S(=O)(=O)n3cc[n+](C)c3)CCN(C)C2)CC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H30N5O3S.CHF3O3S/c1-17-6-10-26(11-7-17)23(29)18-4-5-21-19(14-18)20-15-24(2)9-8-22(20)28(21)32(30,31)27-13-12-25(3)16-27;2-1(3,4)8(5,6)7/h4-5,12-14,16-17H,6-11,15H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YUOAZVQBKSEOIE-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 128.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|