C16H27NO5S — CID 90763194
[5-(3-amino-1-hydroxypropyl)cyclohexa-2,4-dien-1-yl]sulfonyl-cyclohexylmethanediol (PubChem CID 90763194) has the molecular formula C16H27NO5S and a molecular weight of 345.46 g/mol. Its IUPAC name is [5-(3-amino-1-hydroxypropyl)cyclohexa-2,4-dien-1-yl]sulfonyl-cyclohexylmethanediol.
| Compound Name | [5-(3-amino-1-hydroxypropyl)cyclohexa-2,4-dien-1-yl]sulfonyl-cyclohexylmethanediol |
|---|---|
| PubChem CID | 90763194 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [5-(3-amino-1-hydroxypropyl)cyclohexa-2,4-dien-1-yl]sulfonyl-cyclohexylmethanediol |
| SMILES | NCCC(O)C1=CC=CC(S(=O)(=O)C(O)(O)C2CCCCC2)C1 |
| InChI | InChI=1S/C16H27NO5S/c17-10-9-15(18)12-5-4-8-14(11-12)23(21,22)16(19,20)13-6-2-1-3-7-13/h4-5,8,13-15,18-20H,1-3,6-7,9-11,17H2 |
| InChIKey | BSINJMPPUKHFSU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|