C19H37NO2S — CID 143954806
(E)-1-amino-6-(cyclohexylmethylsulfinyl)-4-[(Z)-prop-1-enyl]hept-4-en-3-ol;ethane (PubChem CID 143954806) has the molecular formula C19H37NO2S and a molecular weight of 343.58 g/mol. Its IUPAC name is (E)-1-amino-6-(cyclohexylmethylsulfinyl)-4-[(Z)-prop-1-enyl]hept-4-en-3-ol;ethane.
| Compound Name | (E)-1-amino-6-(cyclohexylmethylsulfinyl)-4-[(Z)-prop-1-enyl]hept-4-en-3-ol;ethane |
|---|---|
| PubChem CID | 143954806 |
| Molecular Formula | C19H37NO2S |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (E)-1-amino-6-(cyclohexylmethylsulfinyl)-4-[(Z)-prop-1-enyl]hept-4-en-3-ol;ethane |
| SMILES | C/C=C\C(=C/C(C)S(=O)CC1CCCCC1)C(O)CCN.CC |
| InChI | InChI=1S/C17H31NO2S.C2H6/c1-3-7-16(17(19)10-11-18)12-14(2)21(20)13-15-8-5-4-6-9-15;1-2/h3,7,12,14-15,17,19H,4-6,8-11,13,18H2,1-2H3;1-2H3/b7-3-,16-12+; |
| InChIKey | QNAUBNYDFMBBEC-IWBCKPJKSA-N |
| XLogP | 3.94 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|