C17H29NO2S — CID 143954773
(3E,5E)-8-amino-5-[2-(cyclohexylmethylsulfanyl)ethylidene]octa-1,3-diene-3,6-diol (PubChem CID 143954773) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is (3E,5E)-8-amino-5-[2-(cyclohexylmethylsulfanyl)ethylidene]octa-1,3-diene-3,6-diol.
| Compound Name | (3E,5E)-8-amino-5-[2-(cyclohexylmethylsulfanyl)ethylidene]octa-1,3-diene-3,6-diol |
|---|---|
| PubChem CID | 143954773 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (3E,5E)-8-amino-5-[2-(cyclohexylmethylsulfanyl)ethylidene]octa-1,3-diene-3,6-diol |
| SMILES | C=C/C(O)=C\C(=C/CSCC1CCCCC1)C(O)CCN |
| InChI | InChI=1S/C17H29NO2S/c1-2-16(19)12-15(17(20)8-10-18)9-11-21-13-14-6-4-3-5-7-14/h2,9,12,14,17,19-20H,1,3-8,10-11,13,18H2/b15-9+,16-12+ |
| InChIKey | RPEZOFPSMDLABJ-WFWBVLJZSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|