C13H23NOS — CID 90922029
3-amino-1-(3-butylsulfanylcyclohexa-2,4-dien-1-yl)propan-1-ol (PubChem CID 90922029) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 3-amino-1-(3-butylsulfanylcyclohexa-2,4-dien-1-yl)propan-1-ol.
| Compound Name | 3-amino-1-(3-butylsulfanylcyclohexa-2,4-dien-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 90922029 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 3-amino-1-(3-butylsulfanylcyclohexa-2,4-dien-1-yl)propan-1-ol |
| SMILES | CCCCSC1=CC(C(O)CCN)CC=C1 |
| InChI | InChI=1S/C13H23NOS/c1-2-3-9-16-12-6-4-5-11(10-12)13(15)7-8-14/h4,6,10-11,13,15H,2-3,5,7-9,14H2,1H3 |
| InChIKey | ZOZSWYVMTSZDOQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|