C17H31NOS — CID 143954876
(Z,4E)-1-amino-4-[2-(cyclohexylmethylsulfanyl)ethylidene]-2-methylhept-5-en-3-ol (PubChem CID 143954876) has the molecular formula C17H31NOS and a molecular weight of 297.51 g/mol. Its IUPAC name is (Z,4E)-1-amino-4-[2-(cyclohexylmethylsulfanyl)ethylidene]-2-methylhept-5-en-3-ol.
| Compound Name | (Z,4E)-1-amino-4-[2-(cyclohexylmethylsulfanyl)ethylidene]-2-methylhept-5-en-3-ol |
|---|---|
| PubChem CID | 143954876 |
| Molecular Formula | C17H31NOS |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (Z,4E)-1-amino-4-[2-(cyclohexylmethylsulfanyl)ethylidene]-2-methylhept-5-en-3-ol |
| SMILES | C/C=C\C(=C/CSCC1CCCCC1)C(O)C(C)CN |
| InChI | InChI=1S/C17H31NOS/c1-3-7-16(17(19)14(2)12-18)10-11-20-13-15-8-5-4-6-9-15/h3,7,10,14-15,17,19H,4-6,8-9,11-13,18H2,1-2H3/b7-3-,16-10+ |
| InChIKey | GPJAEKVTVHSJET-AZVQNHGXSA-N |
| XLogP | 3.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|