C18H33NOS — CID 90825005
1-amino-6-(3-cyclohexylpropylsulfanyl)nona-5,7-dien-3-ol (PubChem CID 90825005) has the molecular formula C18H33NOS and a molecular weight of 311.54 g/mol. Its IUPAC name is 1-amino-6-(3-cyclohexylpropylsulfanyl)nona-5,7-dien-3-ol.
| Compound Name | 1-amino-6-(3-cyclohexylpropylsulfanyl)nona-5,7-dien-3-ol |
|---|---|
| PubChem CID | 90825005 |
| Molecular Formula | C18H33NOS |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | 1-amino-6-(3-cyclohexylpropylsulfanyl)nona-5,7-dien-3-ol |
| SMILES | CC=CC(=CCC(O)CCN)SCCCC1CCCCC1 |
| InChI | InChI=1S/C18H33NOS/c1-2-7-18(12-11-17(20)13-14-19)21-15-6-10-16-8-4-3-5-9-16/h2,7,12,16-17,20H,3-6,8-11,13-15,19H2,1H3 |
| InChIKey | MQBLAUROWFBJBK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|