C18H31NO2S — CID 143954833
(2E,4E,6E)-10-amino-5-(cyclohexylmethylsulfanyl)-7-methyldeca-2,4,6-triene-2,8-diol (PubChem CID 143954833) has the molecular formula C18H31NO2S and a molecular weight of 325.52 g/mol. Its IUPAC name is (2E,4E,6E)-10-amino-5-(cyclohexylmethylsulfanyl)-7-methyldeca-2,4,6-triene-2,8-diol.
| Compound Name | (2E,4E,6E)-10-amino-5-(cyclohexylmethylsulfanyl)-7-methyldeca-2,4,6-triene-2,8-diol |
|---|---|
| PubChem CID | 143954833 |
| Molecular Formula | C18H31NO2S |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | (2E,4E,6E)-10-amino-5-(cyclohexylmethylsulfanyl)-7-methyldeca-2,4,6-triene-2,8-diol |
| SMILES | C/C(O)=C\C=C(/C=C(\C)C(O)CCN)SCC1CCCCC1 |
| InChI | InChI=1S/C18H31NO2S/c1-14(18(21)10-11-19)12-17(9-8-15(2)20)22-13-16-6-4-3-5-7-16/h8-9,12,16,18,20-21H,3-7,10-11,13,19H2,1-2H3/b14-12+,15-8+,17-9+ |
| InChIKey | HYOJNMYIFFLCSI-ACJJANTQSA-N |
| XLogP | 4.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|