C17H29NO3S — CID 143954835
(4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]octa-4,6-diene-2,2,3-triol (PubChem CID 143954835) has the molecular formula C17H29NO3S and a molecular weight of 327.49 g/mol. Its IUPAC name is (4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]octa-4,6-diene-2,2,3-triol.
| Compound Name | (4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]octa-4,6-diene-2,2,3-triol |
|---|---|
| PubChem CID | 143954835 |
| Molecular Formula | C17H29NO3S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]octa-4,6-diene-2,2,3-triol |
| SMILES | C/C=C\C=C(/C=C/SCC1CCCCC1)C(O)C(O)(O)CN |
| InChI | InChI=1S/C17H29NO3S/c1-2-3-9-15(16(19)17(20,21)13-18)10-11-22-12-14-7-5-4-6-8-14/h2-3,9-11,14,16,19-21H,4-8,12-13,18H2,1H3/b3-2-,11-10+,15-9+ |
| InChIKey | HUROQNWXOILMIG-RBNJMYHMSA-N |
| XLogP | 2.32 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|