C18H31NO3S — CID 143954899
(4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]nona-4,6-diene-2,2,3-triol (PubChem CID 143954899) has the molecular formula C18H31NO3S and a molecular weight of 341.52 g/mol. Its IUPAC name is (4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]nona-4,6-diene-2,2,3-triol.
| Compound Name | (4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]nona-4,6-diene-2,2,3-triol |
|---|---|
| PubChem CID | 143954899 |
| Molecular Formula | C18H31NO3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (4E,6Z)-1-amino-4-[(E)-2-(cyclohexylmethylsulfanyl)ethenyl]nona-4,6-diene-2,2,3-triol |
| SMILES | CC/C=C\C=C(/C=C/SCC1CCCCC1)C(O)C(O)(O)CN |
| InChI | InChI=1S/C18H31NO3S/c1-2-3-5-10-16(17(20)18(21,22)14-19)11-12-23-13-15-8-6-4-7-9-15/h3,5,10-12,15,17,20-22H,2,4,6-9,13-14,19H2,1H3/b5-3-,12-11+,16-10+ |
| InChIKey | VKZZPFRBHADZCQ-OQQAZLOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|