C17H29NO2S — CID 143954825
(E,4Z)-7-amino-4-[2-(cyclohexylmethylsulfanyl)prop-2-enylidene]hept-2-ene-3,5-diol (PubChem CID 143954825) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is (E,4Z)-7-amino-4-[2-(cyclohexylmethylsulfanyl)prop-2-enylidene]hept-2-ene-3,5-diol.
| Compound Name | (E,4Z)-7-amino-4-[2-(cyclohexylmethylsulfanyl)prop-2-enylidene]hept-2-ene-3,5-diol |
|---|---|
| PubChem CID | 143954825 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (E,4Z)-7-amino-4-[2-(cyclohexylmethylsulfanyl)prop-2-enylidene]hept-2-ene-3,5-diol |
| SMILES | C=C(/C=C(C(\O)=C/C)/C(O)CCN)SCC1CCCCC1 |
| InChI | InChI=1S/C17H29NO2S/c1-3-16(19)15(17(20)9-10-18)11-13(2)21-12-14-7-5-4-6-8-14/h3,11,14,17,19-20H,2,4-10,12,18H2,1H3/b15-11+,16-3+ |
| InChIKey | LDSXOJSVHBVIQI-AXYZJDAESA-N |
| XLogP | 3.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|