C23H32O3 — CID 90763204
2-[3,5-bis(3-methoxypropyl)phenyl]-1-phenylpropan-2-ol (PubChem CID 90763204) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-[3,5-bis(3-methoxypropyl)phenyl]-1-phenylpropan-2-ol.
| Compound Name | 2-[3,5-bis(3-methoxypropyl)phenyl]-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 90763204 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-[3,5-bis(3-methoxypropyl)phenyl]-1-phenylpropan-2-ol |
| SMILES | COCCCc1cc(CCCOC)cc(C(C)(O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H32O3/c1-23(24,18-19-9-5-4-6-10-19)22-16-20(11-7-13-25-2)15-21(17-22)12-8-14-26-3/h4-6,9-10,15-17,24H,7-8,11-14,18H2,1-3H3 |
| InChIKey | YVBDJHHLTFJXHP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|