C25H27ClN4O5S — CID 90764506
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)oxane-2,4-dione (PubChem CID 90764506) has the molecular formula C25H27ClN4O5S and a molecular weight of 531.03 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 90764506 |
| Molecular Formula | C25H27ClN4O5S |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nc4ncccn4n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C25H27ClN4O5S/c1-33-19-13-20(34-2)17(26)12-15(19)8-9-25(16-6-3-4-7-16)14-18(31)21(22(32)35-25)36-24-28-23-27-10-5-11-30(23)29-24/h5,10-13,16,21H,3-4,6-9,14H2,1-2H3 |
| InChIKey | XQHPAWPJIRMDQT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|