C28H31ClN4O7S — CID 11296384
ethyl 2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 11296384) has the molecular formula C28H31ClN4O7S and a molecular weight of 603.10 g/mol. Its IUPAC name is ethyl 2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 11296384 |
| Molecular Formula | C28H31ClN4O7S |
| Molecular Weight | 603.10 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | ethyl 2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2nc(SC3C(=O)CC(CCc4cc(Cl)c(OC)cc4OC)(C4CCCC4)OC3=O)nn2c1 |
| InChI | InChI=1S/C28H31ClN4O7S/c1-4-39-24(35)17-14-30-26-31-27(32-33(26)15-17)41-23-20(34)13-28(40-25(23)36,18-7-5-6-8-18)10-9-16-11-19(29)22(38-3)12-21(16)37-2/h11-12,14-15,18,23H,4-10,13H2,1-3H3 |
| InChIKey | JNGRIHJCEUQWDZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 131.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.10 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|