C29H33ClN4O6S — CID 91229447
ethyl 2-[4-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-4-cyclopentyl-2,6-dioxocyclohexyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 91229447) has the molecular formula C29H33ClN4O6S and a molecular weight of 601.13 g/mol. Its IUPAC name is ethyl 2-[4-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-4-cyclopentyl-2,6-dioxocyclohexyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[4-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-4-cyclopentyl-2,6-dioxocyclohexyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 91229447 |
| Molecular Formula | C29H33ClN4O6S |
| Molecular Weight | 601.13 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | ethyl 2-[4-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-4-cyclopentyl-2,6-dioxocyclohexyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2nc(SC3C(=O)CC(CCc4cc(Cl)c(OC)cc4OC)(C4CCCC4)CC3=O)nn2c1 |
| InChI | InChI=1S/C29H33ClN4O6S/c1-4-40-26(37)18-15-31-27-32-28(33-34(27)16-18)41-25-21(35)13-29(14-22(25)36,19-7-5-6-8-19)10-9-17-11-20(30)24(39-3)12-23(17)38-2/h11-12,15-16,19,25H,4-10,13-14H2,1-3H3 |
| InChIKey | BICQYPZYXNTNJG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 121.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.13 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|