C26H29ClN4O5S — CID 91472184
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91472184) has the molecular formula C26H29ClN4O5S and a molecular weight of 545.06 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91472184 |
| Molecular Formula | C26H29ClN4O5S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nc4ncc(C)cn4n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C26H29ClN4O5S/c1-15-13-28-24-29-25(30-31(24)14-15)37-22-19(32)12-26(36-23(22)33,17-6-4-5-7-17)9-8-16-10-18(27)21(35-3)11-20(16)34-2/h10-11,13-14,17,22H,4-9,12H2,1-3H3 |
| InChIKey | NGELQOCCPXJNLB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 104.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|