C21H27NO5 — CID 90764905
5-(3-morpholin-4-ylpropyl)-3-(4-phenylbutanoyl)oxolane-2,4-dione (PubChem CID 90764905) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 5-(3-morpholin-4-ylpropyl)-3-(4-phenylbutanoyl)oxolane-2,4-dione.
| Compound Name | 5-(3-morpholin-4-ylpropyl)-3-(4-phenylbutanoyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 90764905 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 5-(3-morpholin-4-ylpropyl)-3-(4-phenylbutanoyl)oxolane-2,4-dione |
| SMILES | O=C(CCCc1ccccc1)C1C(=O)OC(CCCN2CCOCC2)C1=O |
| InChI | InChI=1S/C21H27NO5/c23-17(9-4-8-16-6-2-1-3-7-16)19-20(24)18(27-21(19)25)10-5-11-22-12-14-26-15-13-22/h1-3,6-7,18-19H,4-5,8-15H2 |
| InChIKey | JQVYRCKBMNCGQU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|