C20H26FNO5 — CID 55380370
ethyl 1-[2-[3-(4-fluorophenyl)propanoyloxy]propanoyl]piperidine-4-carboxylate (PubChem CID 55380370) has the molecular formula C20H26FNO5 and a molecular weight of 379.43 g/mol. Its IUPAC name is ethyl 1-[2-[3-(4-fluorophenyl)propanoyloxy]propanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[3-(4-fluorophenyl)propanoyloxy]propanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55380370 |
| Molecular Formula | C20H26FNO5 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | ethyl 1-[2-[3-(4-fluorophenyl)propanoyloxy]propanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)OC(=O)CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H26FNO5/c1-3-26-20(25)16-10-12-22(13-11-16)19(24)14(2)27-18(23)9-6-15-4-7-17(21)8-5-15/h4-5,7-8,14,16H,3,6,9-13H2,1-2H3 |
| InChIKey | RQVXNDFWSYNTFF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |