C26H28N2O6 — CID 55504842
ethyl 1-[2-[2-(9-oxoacridin-10-yl)acetyl]oxypropanoyl]piperidine-4-carboxylate (PubChem CID 55504842) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is ethyl 1-[2-[2-(9-oxoacridin-10-yl)acetyl]oxypropanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(9-oxoacridin-10-yl)acetyl]oxypropanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55504842 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | ethyl 1-[2-[2-(9-oxoacridin-10-yl)acetyl]oxypropanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)OC(=O)Cn2c3ccccc3c(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C26H28N2O6/c1-3-33-26(32)18-12-14-27(15-13-18)25(31)17(2)34-23(29)16-28-21-10-6-4-8-19(21)24(30)20-9-5-7-11-22(20)28/h4-11,17-18H,3,12-16H2,1-2H3 |
| InChIKey | UYXBEHLHEZSPQW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|