C21H33NO4 — CID 90765052
benzene;methanol;N-(3-oxobutan-2-yl)propanamide (PubChem CID 90765052) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is benzene;methanol;N-(3-oxobutan-2-yl)propanamide.
| Compound Name | benzene;methanol;N-(3-oxobutan-2-yl)propanamide |
|---|---|
| PubChem CID | 90765052 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | benzene;methanol;N-(3-oxobutan-2-yl)propanamide |
| SMILES | CCC(=O)NC(C)C(C)=O.CO.CO.c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C7H13NO2.2C6H6.2CH4O/c1-4-7(10)8-5(2)6(3)9;2*1-2-4-6-5-3-1;2*1-2/h5H,4H2,1-3H3,(H,8,10);2*1-6H;2*2H,1H3 |
| InChIKey | IMNJEPLFIXWMRC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |