C23H37NO5 — CID 91491513
benzene;methanol;methyl 2-(butanoylamino)butanoate (PubChem CID 91491513) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is benzene;methanol;methyl 2-(butanoylamino)butanoate.
| Compound Name | benzene;methanol;methyl 2-(butanoylamino)butanoate |
|---|---|
| PubChem CID | 91491513 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | benzene;methanol;methyl 2-(butanoylamino)butanoate |
| SMILES | CCCC(=O)NC(CC)C(=O)OC.CO.CO.c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C9H17NO3.2C6H6.2CH4O/c1-4-6-8(11)10-7(5-2)9(12)13-3;2*1-2-4-6-5-3-1;2*1-2/h7H,4-6H2,1-3H3,(H,10,11);2*1-6H;2*2H,1H3 |
| InChIKey | KOWYROQLHRAPDI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |