C15H19NO5Te — CID 50994666
dimethyl (2S)-2-(3-phenyltellanylpropanoylamino)butanedioate (PubChem CID 50994666) has the molecular formula C15H19NO5Te and a molecular weight of 420.92 g/mol. Its IUPAC name is dimethyl (2S)-2-(3-phenyltellanylpropanoylamino)butanedioate.
| Compound Name | dimethyl (2S)-2-(3-phenyltellanylpropanoylamino)butanedioate |
|---|---|
| PubChem CID | 50994666 |
| Molecular Formula | C15H19NO5Te |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | dimethyl (2S)-2-(3-phenyltellanylpropanoylamino)butanedioate |
| SMILES | COC(=O)C[C@H](NC(=O)CC[Te]c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H19NO5Te/c1-20-14(18)10-12(15(19)21-2)16-13(17)8-9-22-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | XCGSSBDGIGMVKP-LBPRGKRZSA-N |
| XLogP | 0.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|