C26H23F3NO5P — CID 11443749
dimethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 11443749) has the molecular formula C26H23F3NO5P and a molecular weight of 517.44 g/mol. Its IUPAC name is dimethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | dimethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 11443749 |
| Molecular Formula | C26H23F3NO5P |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | dimethyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | COC(=O)C(C(NC(=O)C(F)(F)F)C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23F3NO5P/c1-34-23(31)21(30-25(33)26(27,28)29)22(24(32)35-2)36(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,21H,1-2H3,(H,30,33) |
| InChIKey | VNCPIYKCILFJGH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|