C25H29N5O5 — CID 90765112
[4-[[5-carbamoyl-4-[(4-propan-2-ylphenyl)carbamoylamino]-1H-imidazol-2-yl]methyl]phenyl] butaneperoxoate (PubChem CID 90765112) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is [4-[[5-carbamoyl-4-[(4-propan-2-ylphenyl)carbamoylamino]-1H-imidazol-2-yl]methyl]phenyl] butaneperoxoate.
| Compound Name | [4-[[5-carbamoyl-4-[(4-propan-2-ylphenyl)carbamoylamino]-1H-imidazol-2-yl]methyl]phenyl] butaneperoxoate |
|---|---|
| PubChem CID | 90765112 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | [4-[[5-carbamoyl-4-[(4-propan-2-ylphenyl)carbamoylamino]-1H-imidazol-2-yl]methyl]phenyl] butaneperoxoate |
| SMILES | CCCC(=O)OOc1ccc(Cc2nc(NC(=O)Nc3ccc(C(C)C)cc3)c(C(N)=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H29N5O5/c1-4-5-21(31)35-34-19-12-6-16(7-13-19)14-20-28-22(23(26)32)24(29-20)30-25(33)27-18-10-8-17(9-11-18)15(2)3/h6-13,15H,4-5,14H2,1-3H3,(H2,26,32)(H,28,29)(H2,27,30,33) |
| InChIKey | LNEYVQXOYDMNKO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|