C18H29N — CID 90766013
(5S,9bS)-2,4,5,7,7,9b-hexamethyl-5,6,6a,8,9,9a-hexahydro-4H-benzo[de]quinoline (PubChem CID 90766013) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (5S,9bS)-2,4,5,7,7,9b-hexamethyl-5,6,6a,8,9,9a-hexahydro-4H-benzo[de]quinoline.
| Compound Name | (5S,9bS)-2,4,5,7,7,9b-hexamethyl-5,6,6a,8,9,9a-hexahydro-4H-benzo[de]quinoline |
|---|---|
| PubChem CID | 90766013 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (5S,9bS)-2,4,5,7,7,9b-hexamethyl-5,6,6a,8,9,9a-hexahydro-4H-benzo[de]quinoline |
| SMILES | CC1=NC2CCC(C)(C)C3C[C@H](C)C(C)C(=C1)[C@@]23C |
| InChI | InChI=1S/C18H29N/c1-11-9-15-17(4,5)8-7-16-18(15,6)14(13(11)3)10-12(2)19-16/h10-11,13,15-16H,7-9H2,1-6H3/t11-,13?,15?,16?,18+/m0/s1 |
| InChIKey | CCSVIGFVFFKBEO-BVYWKXBDSA-N |
| XLogP | 4.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |