C29H37FN2O3Si — CID 90766860
3-[(4-fluorophenyl)methyl]-5-(hydroxymethyl)-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol (PubChem CID 90766860) has the molecular formula C29H37FN2O3Si and a molecular weight of 508.71 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-5-(hydroxymethyl)-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol.
| Compound Name | 3-[(4-fluorophenyl)methyl]-5-(hydroxymethyl)-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
|---|---|
| PubChem CID | 90766860 |
| Molecular Formula | C29H37FN2O3Si |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-5-(hydroxymethyl)-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
| SMILES | CC(C)[Si](Oc1c2ncc(Cc3ccc(F)cc3)cc2c(CO)c2cn(C)c(O)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H37FN2O3Si/c1-17(2)36(18(3)4,19(5)6)35-28-26-24(15-32(7)29(26)34)25(16-33)23-13-21(14-31-27(23)28)12-20-8-10-22(30)11-9-20/h8-11,13-15,17-19,33-34H,12,16H2,1-7H3 |
| InChIKey | WYCBPHNQDBLYSZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|