C24H31F4N3O3 — CID 90769828
2-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 90769828) has the molecular formula C24H31F4N3O3 and a molecular weight of 485.52 g/mol. Its IUPAC name is 2-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 90769828 |
| Molecular Formula | C24H31F4N3O3 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 2-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCCN1CCN(c3ccccc3OCC(F)(F)C(F)F)CC1)CCCC2 |
| InChI | InChI=1S/C24H31F4N3O3/c25-23(26)24(27,28)16-34-20-9-4-3-8-19(20)30-14-12-29(13-15-30)10-5-11-31-21(32)17-6-1-2-7-18(17)22(31)33/h3-4,8-9,23,32-33H,1-2,5-7,10-16H2 |
| InChIKey | VPIPMXXDBXDIIU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|