C16H20FN3O3 — CID 54268571
2-[2-(2,3-diamino-5-fluorophenoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54268571) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[2-(2,3-diamino-5-fluorophenoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[2-(2,3-diamino-5-fluorophenoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54268571 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[2-(2,3-diamino-5-fluorophenoxy)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Nc1cc(F)cc(OCCn2c(O)c3c(c2O)CCCC3)c1N |
| InChI | InChI=1S/C16H20FN3O3/c17-9-7-12(18)14(19)13(8-9)23-6-5-20-15(21)10-3-1-2-4-11(10)16(20)22/h7-8,21-22H,1-6,18-19H2 |
| InChIKey | RINGOJFGKFPOFY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|