C23H30F3N3O4 — CID 91003987
2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol (PubChem CID 91003987) has the molecular formula C23H30F3N3O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol.
| Compound Name | 2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 91003987 |
| Molecular Formula | C23H30F3N3O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol |
| SMILES | Oc1c2c(c(O)n1CCCN1CCN(c3ccccc3OCC(F)(F)F)CC1)CC(O)CC2 |
| InChI | InChI=1S/C23H30F3N3O4/c24-23(25,26)15-33-20-5-2-1-4-19(20)28-12-10-27(11-13-28)8-3-9-29-21(31)17-7-6-16(30)14-18(17)22(29)32/h1-2,4-5,16,30-32H,3,6-15H2 |
| InChIKey | OBOCKVDVTNPREK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |