C24H34FN3O6 — CID 90791394
2-[3-[4-(5-fluoro-4-hydroxy-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol (PubChem CID 90791394) has the molecular formula C24H34FN3O6 and a molecular weight of 479.55 g/mol. Its IUPAC name is 2-[3-[4-(5-fluoro-4-hydroxy-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol.
| Compound Name | 2-[3-[4-(5-fluoro-4-hydroxy-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
|---|---|
| PubChem CID | 90791394 |
| Molecular Formula | C24H34FN3O6 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[3-[4-(5-fluoro-4-hydroxy-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
| SMILES | CC(C)Oc1cc(O)c(F)cc1N1CCN(CCCn2c(O)c3c(c2O)CC(O)C(O)C3)CC1 |
| InChI | InChI=1S/C24H34FN3O6/c1-14(2)34-22-13-19(29)17(25)12-18(22)27-8-6-26(7-9-27)4-3-5-28-23(32)15-10-20(30)21(31)11-16(15)24(28)33/h12-14,20-21,29-33H,3-11H2,1-2H3 |
| InChIKey | JSAAUNSNIUYSGZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 121.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |