C24H35FN3O8P — CID 90779475
[2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate (PubChem CID 90779475) has the molecular formula C24H35FN3O8P and a molecular weight of 543.53 g/mol. Its IUPAC name is [2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate.
| Compound Name | [2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90779475 |
| Molecular Formula | C24H35FN3O8P |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | [2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
| SMILES | CCCOc1ccc(F)cc1N1CCN(CCCn2c(O)c3c(c2O)CC(OP(=O)(O)O)C(O)C3)CC1 |
| InChI | InChI=1S/C24H35FN3O8P/c1-2-12-35-21-5-4-16(25)13-19(21)27-10-8-26(9-11-27)6-3-7-28-23(30)17-14-20(29)22(36-37(32,33)34)15-18(17)24(28)31/h4-5,13,20,22,29-31H,2-3,6-12,14-15H2,1H3,(H2,32,33,34) |
| InChIKey | RUGBTSVWSWTTSA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 148.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|