C24H32FN3O3 — CID 90784410
2-[3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 90784410) has the molecular formula C24H32FN3O3 and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 90784410 |
| Molecular Formula | C24H32FN3O3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC(C)Oc1cc(F)ccc1N1CCN(CCCn2c(O)c3c(c2O)CC=CC3)CC1 |
| InChI | InChI=1S/C24H32FN3O3/c1-17(2)31-22-16-18(25)8-9-21(22)27-14-12-26(13-15-27)10-5-11-28-23(29)19-6-3-4-7-20(19)24(28)30/h3-4,8-9,16-17,29-30H,5-7,10-15H2,1-2H3 |
| InChIKey | JGLYLRUMDPJXGR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|