C22H26F3N3O3 — CID 90999009
2-[2-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]ethyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 90999009) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-[2-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]ethyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[2-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]ethyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 90999009 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[2-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]ethyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCN1CCN(c3ccccc3OCC(F)(F)F)CC1)CC=CC2 |
| InChI | InChI=1S/C22H26F3N3O3/c23-22(24,25)15-31-19-8-4-3-7-18(19)27-12-9-26(10-13-27)11-14-28-20(29)16-5-1-2-6-17(16)21(28)30/h1-4,7-8,29-30H,5-6,9-15H2 |
| InChIKey | ZIQXCHILFPWDSK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|