C17H22F3N5O2 — CID 90770021
2-amino-2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 90770021) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-amino-2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-amino-2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 90770021 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-amino-2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN1CCN(C(=O)c2ccc(/N=C(\N)C(=O)NCC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H22F3N5O2/c1-2-24-7-9-25(10-8-24)16(27)12-3-5-13(6-4-12)23-14(21)15(26)22-11-17(18,19)20/h3-6H,2,7-11H2,1H3,(H2,21,23)(H,22,26) |
| InChIKey | HKCZJLZXCUDYBO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|