About CID 90770996
CID 90770996 (PubChem CID 90770996) has the molecular formula C20H29O-
and a molecular weight of 285.45 g/mol.
Molecular Properties
| Compound Name | CID 90770996 |
| PubChem CID | 90770996 |
| Molecular Formula | C20H29O- |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | — |
| SMILES | [CH2-]c1c(C2CCCCC2)cc(OC)cc1C1CCCCC1 |
| InChI | InChI=1S/C20H29O/c1-15-19(16-9-5-3-6-10-16)13-18(21-2)14-20(15)17-11-7-4-8-12-17/h13-14,16-17H,1,3-12H2,2H3/q-1 |
| InChIKey | QCVOGGYRYHJXOT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 90770996 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90770996?
The IUPAC name of CID 90770996 (CID 90770996) is not available.
What is the SMILES notation for CID 90770996?
The canonical SMILES for CID 90770996 is [CH2-]c1c(C2CCCCC2)cc(OC)cc1C1CCCCC1.
What is the InChIKey of CID 90770996?
The InChIKey is QCVOGGYRYHJXOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29O/c1-15-19(16-9-5-3-6-10-16)13-18(21-2)14-20(15)17-11-7-4-8-12-17/h13-14,16-17H,1,3-12H2,2H3/q-1.
What are the key properties of CID 90770996?
CID 90770996 has a molecular weight of 285.45 g/mol, XLogP of 5.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90770996 is sourced from PubChem (CID 90770996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).