C20H20N2O3 — CID 90771110
1-[6-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 90771110) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[6-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[6-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 90771110 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[6-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2ccc(-n3c(O)c4c(c3O)[C@H]3C=C[C@@H]4CC3)cc21 |
| InChI | InChI=1S/C20H20N2O3/c1-11(23)21-9-8-12-6-7-15(10-16(12)21)22-19(24)17-13-2-3-14(5-4-13)18(17)20(22)25/h2-3,6-7,10,13-14,24-25H,4-5,8-9H2,1H3/t13-,14+ |
| InChIKey | NTYOFRFTZUWUOX-OKILXGFUSA-N |
| XLogP | 3.33 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|