C18H17F3N2O3 — CID 91009974
1-[(1R,7S)-3,5-dihydroxy-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-dien-8-yl]ethanone (PubChem CID 91009974) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 1-[(1R,7S)-3,5-dihydroxy-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-dien-8-yl]ethanone.
| Compound Name | 1-[(1R,7S)-3,5-dihydroxy-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-dien-8-yl]ethanone |
|---|---|
| PubChem CID | 91009974 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[(1R,7S)-3,5-dihydroxy-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-dien-8-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2CC[C@H]1c1c2c(O)n(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C18H17F3N2O3/c1-9(24)22-8-10-5-6-13(22)15-14(10)16(25)23(17(15)26)12-4-2-3-11(7-12)18(19,20)21/h2-4,7,10,13,25-26H,5-6,8H2,1H3/t10-,13-/m0/s1 |
| InChIKey | ZMTBJSFQPMZQCZ-GWCFXTLKSA-N |
| XLogP | 3.69 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |