C13H16F3NO — CID 117017973
5,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol (PubChem CID 117017973) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 5,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
| Compound Name | 5,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 117017973 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| SMILES | CC1(C)CC(O)CN1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO/c1-12(2)7-11(18)8-17(12)10-5-3-4-9(6-10)13(14,15)16/h3-6,11,18H,7-8H2,1-2H3 |
| InChIKey | WFTNFZWZXHQIDJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |