C23H20F3N3O2S — CID 90771545
5-methoxy-N-phenyl-N-(pyridin-4-ylmethylsulfanyl)-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 90771545) has the molecular formula C23H20F3N3O2S and a molecular weight of 459.49 g/mol. Its IUPAC name is 5-methoxy-N-phenyl-N-(pyridin-4-ylmethylsulfanyl)-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-methoxy-N-phenyl-N-(pyridin-4-ylmethylsulfanyl)-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 90771545 |
| Molecular Formula | C23H20F3N3O2S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 5-methoxy-N-phenyl-N-(pyridin-4-ylmethylsulfanyl)-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | COc1cc2c(cc1C(F)(F)F)N(C(=O)N(SCc1ccncc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C23H20F3N3O2S/c1-31-21-13-17-9-12-28(20(17)14-19(21)23(24,25)26)22(30)29(18-5-3-2-4-6-18)32-15-16-7-10-27-11-8-16/h2-8,10-11,13-14H,9,12,15H2,1H3 |
| InChIKey | UMTXCKXVRCIOJP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|