C35H32F3N5O2S2 — CID 70081253
5-methoxy-N-[4-(pyridin-4-ylsulfanylmethyl)phenyl]-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide;4-(pyridin-4-ylsulfanylmethyl)aniline (PubChem CID 70081253) has the molecular formula C35H32F3N5O2S2 and a molecular weight of 675.80 g/mol. Its IUPAC name is 5-methoxy-N-[4-(pyridin-4-ylsulfanylmethyl)phenyl]-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide;4-(pyridin-4-ylsulfanylmethyl)aniline.
| Compound Name | 5-methoxy-N-[4-(pyridin-4-ylsulfanylmethyl)phenyl]-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide;4-(pyridin-4-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 70081253 |
| Molecular Formula | C35H32F3N5O2S2 |
| Molecular Weight | 675.80 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | 5-methoxy-N-[4-(pyridin-4-ylsulfanylmethyl)phenyl]-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxamide;4-(pyridin-4-ylsulfanylmethyl)aniline |
| SMILES | COc1cc2c(cc1C(F)(F)F)N(C(=O)Nc1ccc(CSc3ccncc3)cc1)CC2.Nc1ccc(CSc2ccncc2)cc1 |
| InChI | InChI=1S/C23H20F3N3O2S.C12H12N2S/c1-31-21-12-16-8-11-29(20(16)13-19(21)23(24,25)26)22(30)28-17-4-2-15(3-5-17)14-32-18-6-9-27-10-7-18;13-11-3-1-10(2-4-11)9-15-12-5-7-14-8-6-12/h2-7,9-10,12-13H,8,11,14H2,1H3,(H,28,30);1-8H,9,13H2 |
| InChIKey | RWAQEEHWGUVDNX-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.80 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|