C21H22F3N3O5 — CID 167971379
N-(2,3-dihydro-1H-isoindol-5-yl)-5,6-dimethoxy-2,3-dihydroindole-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 167971379) has the molecular formula C21H22F3N3O5 and a molecular weight of 453.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-isoindol-5-yl)-5,6-dimethoxy-2,3-dihydroindole-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2,3-dihydro-1H-isoindol-5-yl)-5,6-dimethoxy-2,3-dihydroindole-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167971379 |
| Molecular Formula | C21H22F3N3O5 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-(2,3-dihydro-1H-isoindol-5-yl)-5,6-dimethoxy-2,3-dihydroindole-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc2c(cc1OC)N(C(=O)Nc1ccc3c(c1)CNC3)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N3O3.C2HF3O2/c1-24-17-8-12-5-6-22(16(12)9-18(17)25-2)19(23)21-15-4-3-13-10-20-11-14(13)7-15;3-2(4,5)1(6)7/h3-4,7-9,20H,5-6,10-11H2,1-2H3,(H,21,23);(H,6,7) |
| InChIKey | AFPSGDSBKKGOEG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |