C21H21N4O6P — CID 90772651
[6-[4-(2-methyltriazol-4-yl)cyclohepta-1,3,6-trien-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate (PubChem CID 90772651) has the molecular formula C21H21N4O6P and a molecular weight of 456.40 g/mol. Its IUPAC name is [6-[4-(2-methyltriazol-4-yl)cyclohepta-1,3,6-trien-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate.
| Compound Name | [6-[4-(2-methyltriazol-4-yl)cyclohepta-1,3,6-trien-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90772651 |
| Molecular Formula | C21H21N4O6P |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [6-[4-(2-methyltriazol-4-yl)cyclohepta-1,3,6-trien-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
| SMILES | Cn1ncc(C2=CC=C(c3ccc4c(c3)CC3C(COP(=O)(O)O)OC(=O)N43)C=CC2)n1 |
| InChI | InChI=1S/C21H21N4O6P/c1-24-22-11-17(23-24)14-4-2-3-13(5-6-14)15-7-8-18-16(9-15)10-19-20(12-30-32(27,28)29)31-21(26)25(18)19/h2-3,5-9,11,19-20H,4,10,12H2,1H3,(H2,27,28,29) |
| InChIKey | ONKZIQHFEYLSQI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|