C21H21FN5O6P — CID 59243331
[(3R,3aS)-7-fluoro-1-oxo-6-[4-[(2H-triazol-4-ylmethylamino)methyl]phenyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate (PubChem CID 59243331) has the molecular formula C21H21FN5O6P and a molecular weight of 489.40 g/mol. Its IUPAC name is [(3R,3aS)-7-fluoro-1-oxo-6-[4-[(2H-triazol-4-ylmethylamino)methyl]phenyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate.
| Compound Name | [(3R,3aS)-7-fluoro-1-oxo-6-[4-[(2H-triazol-4-ylmethylamino)methyl]phenyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59243331 |
| Molecular Formula | C21H21FN5O6P |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [(3R,3aS)-7-fluoro-1-oxo-6-[4-[(2H-triazol-4-ylmethylamino)methyl]phenyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
| SMILES | O=C1O[C@@H](COP(=O)(O)O)[C@@H]2Cc3cc(-c4ccc(CNCc5cn[nH]n5)cc4)c(F)cc3N12 |
| InChI | InChI=1S/C21H21FN5O6P/c22-17-7-18-14(6-19-20(11-32-34(29,30)31)33-21(28)27(18)19)5-16(17)13-3-1-12(2-4-13)8-23-9-15-10-24-26-25-15/h1-5,7,10,19-20,23H,6,8-9,11H2,(H,24,25,26)(H2,29,30,31)/t19-,20-/m0/s1 |
| InChIKey | IGYZJZJFBZFMMT-PMACEKPBSA-N |
| XLogP | 2.26 |
| TPSA | 149.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|