C20H20N6NaO6P — CID 59243324
sodium [(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl hydrogen phosphate (PubChem CID 59243324) has the molecular formula C20H20N6NaO6P and a molecular weight of 494.38 g/mol. Its IUPAC name is sodium [(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl hydrogen phosphate.
| Compound Name | sodium [(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 59243324 |
| Molecular Formula | C20H20N6NaO6P |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | sodium [(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl hydrogen phosphate |
| SMILES | O=C1O[C@@H](COP(=O)([O-])O)[C@@H]2Cc3cc(-c4ccc(CNCc5cn[nH]n5)nc4)ccc3N12.[Na+] |
| InChI | InChI=1S/C20H21N6O6P.Na/c27-20-26-17-4-2-12(5-14(17)6-18(26)19(32-20)11-31-33(28,29)30)13-1-3-15(22-7-13)8-21-9-16-10-23-25-24-16;/h1-5,7,10,18-19,21H,6,8-9,11H2,(H,23,24,25)(H2,28,29,30);/q;+1/p-1/t18-,19-;/m0./s1 |
| InChIKey | GPTUHHUPDIARJZ-HLRBRJAUSA-M |
| XLogP | -2.11 |
| TPSA | 165.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|