C24H26FN7O4 — CID 90773041
2-[4-[[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]diazenyl]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 90773041) has the molecular formula C24H26FN7O4 and a molecular weight of 495.52 g/mol. Its IUPAC name is 2-[4-[[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]diazenyl]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]diazenyl]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 90773041 |
| Molecular Formula | C24H26FN7O4 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[4-[[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]diazenyl]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C/N=N/c2nc(Nc3ccc(F)cc3)nc(N3CCCCC3)n2)ccc1OCC(=O)O |
| InChI | InChI=1S/C24H26FN7O4/c1-35-20-13-16(5-10-19(20)36-15-21(33)34)14-26-31-23-28-22(27-18-8-6-17(25)7-9-18)29-24(30-23)32-11-3-2-4-12-32/h5-10,13H,2-4,11-12,14-15H2,1H3,(H,33,34)(H,27,28,29,30)/b31-26+ |
| InChIKey | FTZXMTRXHPMUED-GKPLWNPISA-N |
| XLogP | 4.50 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|